![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | 1.1 Introduction.pdf | 2007-06-19 19:03 | 14K | |
| 1.2 Subject Heading List.pdf | 2007-06-19 18:38 | 31K | |
| Lesotho General 1975 - 1978.pdf | 2007-06-19 18:38 | 16M | |
| Lesotho General 1979 - 1981.pdf | 2007-06-19 18:38 | 20M | |
| Lesotho General 1982 - 1983.pdf | 2007-06-19 18:39 | 21M | |
| Lesotho General 1983 - 1985.pdf | 2007-06-19 18:39 | 16M | |
| Lesotho General 1986 - 1989.pdf | 2007-06-19 18:39 | 18M | |
| Lesotho General 1990 - 1993.pdf | 2007-06-19 18:39 | 15M | |
| Lesotho General 1994 - 1995.pdf | 2007-06-19 18:39 | 7.1M | |
| Lesotho General 1996 - 1998.pdf | 2007-06-19 18:39 | 23M | |
| Lesotho Labour 1975 - 1998.pdf | 2007-06-19 18:39 | 2.5M | |
| Malawi General 1975 - 1987.pdf | 2007-06-19 18:39 | 9.8M | |
| Malawi General 1988 - 1993.pdf | 2007-06-19 18:39 | 13M | |
| Malawi General 1994 - 1998.pdf | 2007-06-19 18:39 | 5.5M | |
| Management 1975 - 1988.pdf | 2007-06-19 18:40 | 20M | |
| Management 1989 - 1991.pdf | 2007-06-19 18:40 | 17M | |
| Management 1992.pdf | 2007-06-19 18:40 | 15M | |
| Management 1993.pdf | 2007-06-19 18:40 | 24M | |
| Management 1994 - 1998.pdf | 2007-06-19 18:40 | 7.5M | |
| Manpower Apprentices 1979 - 1998.pdf | 2007-06-19 18:40 | 24M | |
| Manpower Black Mobility 1975 - 1987.pdf | 2007-06-19 18:40 | 16M | |
| Manpower Black Mobility 1988 - 1991.pdf | 2007-06-19 18:41 | 29M | |
| Manpower Black Mobility 1992 - 1993.pdf | 2007-06-19 18:41 | 36M | |
| Manpower Black Mobility 1992.pdf | 2007-06-19 18:41 | 11M | |
| Manpower Black Mobility 1994 - 1995.pdf | 2007-06-19 18:41 | 23M | |
| Manpower Black Mobility 1996 - 1997.pdf | 2007-06-19 18:41 | 26M | |
| Manpower Black Mobility 1998.pdf | 2007-06-19 18:41 | 11M | |
| Manpower General 1975 - 1981.pdf | 2007-06-19 18:42 | 17M | |
| Manpower General 1982 - 1988.pdf | 2007-06-19 18:42 | 28M | |
| Manpower General 1989 - 1991.pdf | 2007-06-19 18:42 | 17M | |
| Manpower General 1992 - 1994.pdf | 2007-06-19 18:42 | 30M | |
| Manpower General 1995 - 1996.pdf | 2007-06-19 18:42 | 20M | |
| Manpower General 1997.pdf | 2007-06-19 18:42 | 17M | |
| Manpower General 1998.pdf | 2007-06-19 18:43 | 26M | |
| Manpower Labour Shortages 1975 - 1980.pdf | 2007-06-19 18:43 | 10M | |
| Manpower Labour Shortages 1981 - 1984.pdf | 2007-06-19 18:43 | 28M | |
| Manpower Labour Shortages 1985 - 1995.pdf | 2007-06-19 18:43 | 13M | |
| Manpower Reservation of Work 1975 - 1982.pdf | 2007-06-19 18:43 | 19M | |
| Manpower Reservation of Work 1983 - 1987.pdf | 2007-06-19 18:43 | 10M | |
| Manpower Reservation of Work 1991 - 1995.pdf | 2007-06-19 18:43 | 11M | |
| Manpower Technical Change 1981 - 1992.pdf | 2007-06-19 18:43 | 16M | |
| Manpower Technical Change 1993 - 1998.pdf | 2007-06-19 18:43 | 2.3M | |
| Manpower Training 1975 - 1979.pdf | 2007-06-19 18:44 | 20M | |
| Manpower Training 1980 - 1987.pdf | 2007-06-19 18:44 | 37M | |
| Manpower Training 1988 - 1991.pdf | 2007-06-19 18:44 | 22M | |
| Manpower Training 1992 - 1995.pdf | 2007-06-19 18:44 | 23M | |
| Manpower Training 1996 - 1998.pdf | 2007-06-19 18:44 | 5.2M | |
| Manufacturing Beverages 1975 - 1981.pdf | 2007-06-19 18:44 | 16M | |
| Manufacturing Beverages 1982 - 1986.pdf | 2007-06-19 18:44 | 16M | |
| Manufacturing Beverages 1987 - 1989.pdf | 2007-06-19 18:44 | 18M | |
| Manufacturing Beverages 1990 - 1991.pdf | 2007-06-19 18:45 | 13M | |
| Manufacturing Beverages 1992 - 1993.pdf | 2007-06-19 18:45 | 17M | |
| Manufacturing Beverages 1994 - 1995.pdf | 2007-06-19 18:45 | 13M | |
| Manufacturing Beverages 1996 - 1997.pdf | 2007-06-19 18:45 | 16M | |
| Manufacturing Beverages 1998.pdf | 2007-06-19 18:45 | 6.2M | |
| Manufacturing Chemical Products 1977 - 1980.pdf | 2007-06-19 18:45 | 16M | |
| Manufacturing Chemical Products 1980 - 1982.pdf | 2007-06-19 18:45 | 23M | |
| Manufacturing Chemical Products 1983 - 1984.pdf | 2007-06-19 18:45 | 11M | |
| Manufacturing Chemical Products 1985 - 1986.pdf | 2007-06-19 18:45 | 22M | |
| Manufacturing Chemical Products 1986 - 1987.pdf | 2007-06-19 18:45 | 18M | |
| Manufacturing Chemical Products 1988 - 1989.pdf | 2007-06-19 18:46 | 16M | |
| Manufacturing Chemical Products 1989 - 1990.pdf | 2007-06-19 18:46 | 11M | |
| Manufacturing Chemical Products 1990.pdf | 2007-06-19 18:46 | 9.9M | |
| Manufacturing Chemical Products 1991.pdf | 2007-06-19 18:46 | 11M | |
| Manufacturing Chemical Products 1992.pdf | 2007-06-19 18:46 | 16M | |
| Manufacturing Chemical Products 1993a.pdf | 2007-06-19 18:46 | 11M | |
| Manufacturing Chemical Products 1993b.pdf | 2007-06-19 18:46 | 11M | |
| Manufacturing Chemical Products 1994.pdf | 2007-06-19 18:46 | 17M | |
| Manufacturing Chemical Products 1995a.pdf | 2007-06-19 18:46 | 16M | |
| Manufacturing Chemical Products 1995b.pdf | 2007-06-19 18:46 | 12M | |
| Manufacturing Chemical Products 1996 - 1997.pdf | 2007-06-19 18:46 | 18M | |
| Manufacturing Chemical Products 1996.pdf | 2007-06-19 18:47 | 16M | |
| Manufacturing Chemical Products 1997 - 1998.pdf | 2007-06-19 18:47 | 18M | |
| Manufacturing Chemical Products 1998 - 1999.pdf | 2007-06-19 18:47 | 15M | |
| Manufacturing Clothing 1975 -1980.pdf | 2007-06-19 18:47 | 15M | |
| Manufacturing Clothing 1981 - 1984.pdf | 2007-06-19 18:47 | 17M | |
| Manufacturing Clothing 1985 - 1987.pdf | 2007-06-19 18:47 | 11M | |
| Manufacturing Clothing 1988 - 1990.pdf | 2007-06-19 18:47 | 20M | |
| Manufacturing Clothing 1991 - 1992.pdf | 2007-06-19 18:47 | 16M | |
| Manufacturing Clothing 1993 - 1995.pdf | 2007-06-19 18:47 | 10M | |
| Manufacturing Clothing 1995.pdf | 2007-06-19 18:47 | 6.9M | |
| Manufacturing Clothing 1996 - 1998.pdf | 2007-06-19 18:47 | 17M | |
| Manufacturing Electrical-tronics 1986 - 1991.pdf | 2007-06-19 18:48 | 27M | |
| Manufacturing Electrical-tronics 1992 - 1994.pdf | 2007-06-19 18:48 | 23M | |
| Manufacturing Electricity 1977 - 1987.pdf | 2007-06-19 18:48 | 12M | |
| Manufacturing Engineering 1986 - 1991.pdf | 2007-06-19 18:48 | 26M | |
| Manufacturing Engineering 1992 - 1994.pdf | 2007-06-19 18:48 | 25M | |
| Manufacturing Engineering 1995 - 1998.pdf | 2007-06-19 18:48 | 3.7M | |
| Manufacturing Food 1974 - 1979.pdf | 2007-06-19 18:48 | 14M | |
| Manufacturing Food 1980 - 1981.pdf | 2007-06-19 18:48 | 26M | |
| Manufacturing Food 1980.pdf | 2007-06-19 18:48 | 17M | |
| Manufacturing Food 1982 - 1983.pdf | 2007-06-19 18:49 | 14M | |
| Manufacturing Food 1984 - 1986.pdf | 2007-06-19 18:49 | 15M | |
| Manufacturing Food 1987 - 1989.pdf | 2007-06-19 18:49 | 19M | |
| Manufacturing Food 1990.pdf | 2007-06-19 18:49 | 10M | |
| Manufacturing Food 1991 - 1992.pdf | 2007-06-19 18:49 | 22M | |
| Manufacturing Food 1993 - 1994.pdf | 2007-06-19 18:49 | 15M | |
| Manufacturing Food 1995 - 1998.pdf | 2007-06-19 18:49 | 14M | |
| Manufacturing Footwear 1975 - 1992.pdf | 2007-06-19 18:49 | 12M | |
| Manufacturing Footwear 1993 - 1998.pdf | 2007-06-19 18:49 | 7.3M | |
| Manufacturing Furniture 1975 - 1987.pdf | 2007-06-19 18:49 | 11M | |
| Manufacturing Furniture 1988 - 1990.pdf | 2007-06-19 18:49 | 9.1M | |
| Manufacturing Furniture 1991 - 1993.pdf | 2007-06-19 18:49 | 13M | |
| Manufacturing Furniture 1994 - 1998.pdf | 2007-06-19 18:49 | 2.1M | |
| Manufacturing General 1977 - 1982.pdf | 2007-06-19 18:50 | 27M | |
| Manufacturing General 1983 - 1988.pdf | 2007-06-19 18:50 | 25M | |
| Manufacturing General 1989 - 1990.pdf | 2007-06-19 18:50 | 19M | |
| Manufacturing General 1989.pdf | 2007-06-19 18:50 | 24M | |
| Manufacturing General 1990 - 1991.pdf | 2007-06-19 18:50 | 22M | |
| Manufacturing General 1991 - 1992.pdf | 2007-06-19 18:50 | 19M | |
| Manufacturing General 1991.pdf | 2007-06-19 18:50 | 21M | |
| Manufacturing General 1992 - 1993.pdf | 2007-06-19 18:51 | 33M | |
| Manufacturing General 1992.pdf | 2007-06-19 18:51 | 13M | |
| Manufacturing General 1993 - 1995.pdf | 2007-06-19 18:51 | 28M | |
| Manufacturing General 1995 - 1998.pdf | 2007-06-19 18:51 | 11M | |
| Manufacturing Labour 1976 - 1989.pdf | 2007-06-19 18:51 | 13M | |
| Manufacturing Labour 1990.pdf | 2007-06-19 18:51 | 17M | |
| Manufacturing Labour 1991.pdf | 2007-06-19 18:51 | 17M | |
| Manufacturing Labour 1992 - 1998.pdf | 2007-06-19 18:51 | 16M | |
| Manufacturing Leather Products 1997 - 1998.pdf | 2007-06-19 18:51 | 8.3M | |
| Manufacturing Metal Products 1975 - 1978.pdf | 2007-06-19 18:51 | 14M | |
| Manufacturing Metal Products 1979 - 1980.pdf | 2007-06-19 18:52 | 21M | |
| Manufacturing Metal Products 1980 - 1981.pdf | 2007-06-19 18:52 | 21M | |
| Manufacturing Metal Products 1982.pdf | 2007-06-19 18:52 | 19M | |
| Manufacturing Metal Products 1983.pdf | 2007-06-19 18:52 | 15M | |
| Manufacturing Metal Products 1984.pdf | 2007-06-19 18:52 | 15M | |
| Manufacturing Metal Products 1985.pdf | 2007-06-19 18:52 | 8.2M | |
| Manufacturing Metal Products 1986 - 1987.pdf | 2007-06-19 18:52 | 9.1M | |
| Manufacturing Metal Products 1988 - 1989.pdf | 2007-06-19 18:52 | 14M | |
| Manufacturing Metal Products 1990.pdf | 2007-06-19 18:52 | 13M | |
| Manufacturing Metal Products 1991.pdf | 2007-06-19 18:52 | 9.4M | |
| Manufacturing Metal Products 1992.pdf | 2007-06-19 18:52 | 16M | |
| Manufacturing Metal Products 1993.pdf | 2007-06-19 18:52 | 11M | |
| Manufacturing Metal Products 1994.pdf | 2007-06-19 18:52 | 10M | |
| Manufacturing Metal Products 1995.pdf | 2007-06-19 18:53 | 19M | |
| Manufacturing Metal Products 1996 - 1997.pdf | 2007-06-19 18:53 | 22M | |
| Manufacturing Metal Products 1998 - 1999.pdf | 2007-06-19 18:53 | 7.6M | |
| Manufacturing Miscellaneous 1979 - 1976.pdf | 2007-06-19 18:53 | 12M | |
| Manufacturing Miscellaneous 1987 - 1989.pdf | 2007-06-19 18:53 | 17M | |
| Manufacturing Motor Industry 1975 - 1979.pdf | 2007-06-19 18:53 | 24M | |
| Manufacturing Motor Industry 1980.pdf | 2007-06-19 18:53 | 16M | |
| Manufacturing Motor Industry 1981.pdf | 2007-06-19 18:53 | 22M | |
| Manufacturing Motor Industry 1982.pdf | 2007-06-19 18:53 | 20M | |
| Manufacturing Motor Industry 1983.pdf | 2007-06-19 18:53 | 16M | |
| Manufacturing Motor Industry 1984.pdf | 2007-06-19 18:53 | 12M | |
| Manufacturing Motor Industry 1985.pdf | 2007-06-19 18:54 | 13M | |
| Manufacturing Motor Industry 1986.pdf | 2007-06-19 18:54 | 22M | |
| Manufacturing Motor Industry 1987 - 1988.pdf | 2007-06-19 18:54 | 21M | |
| Manufacturing Motor Industry 1989.pdf | 2007-06-19 18:54 | 14M | |
| Manufacturing Motor Industry 1990.pdf | 2007-06-19 18:54 | 15M | |
| Manufacturing Motor Industry 1991.pdf | 2007-06-19 18:54 | 15M | |
| Manufacturing Motor Industry 1992 - 1993.pdf | 2007-06-19 18:54 | 18M | |
| Manufacturing Motor Industry 1992.pdf | 2007-06-19 18:54 | 16M | |
| Manufacturing Motor Industry 1994 - 1995.pdf | 2007-06-19 18:54 | 19M | |
| Manufacturing Motor Industry 1995 - 1997.pdf | 2007-06-19 18:54 | 19M | |
| Manufacturing Motor Industry 1998.pdf | 2007-06-19 18:54 | 14M | |
| Manufacturing Non-Metal Products 1975 - 1983.pdf | 2007-06-19 18:55 | 18M | |
| Manufacturing Non-Metal Products 1984 - 1989.pdf | 2007-06-19 18:55 | 14M | |
| Manufacturing Non-Metal Products 1990 - 1991.pdf | 2007-06-19 18:55 | 13M | |
| Manufacturing Non-Metal Products 1992 - 1995.pdf | 2007-06-19 18:55 | 16M | |
| Manufacturing Non-Metal Products 1995 - 1998.pdf | 2007-06-19 18:55 | 13M | |
| Manufacturing Paper Products 1975 - 1985.pdf | 2007-06-19 18:55 | 29M | |
| Manufacturing Paper Products 1986 - 1989.pdf | 2007-06-19 18:55 | 30M | |
| Manufacturing Paper Products 1990 - 1992.pdf | 2007-06-19 18:55 | 15M | |
| Manufacturing Paper Products 1993 - 1995.pdf | 2007-06-19 18:55 | 22M | |
| Manufacturing Paper Products 1996 - 1999.pdf | 2007-06-19 18:55 | 9.0M | |
| Manufacturing Printing 1975 - 1986.pdf | 2007-06-19 18:56 | 32M | |
| Manufacturing Printing 1987 - 1992.pdf | 2007-06-19 18:56 | 26M | |
| Manufacturing Printing 1993 - 1998.pdf | 2007-06-19 18:56 | 17M | |
| Manufacturing Rubber Products 1975 - 1987.pdf | 2007-06-19 18:56 | 25M | |
| Manufacturing Rubber Products 1988 - 1992.pdf | 2007-06-19 18:56 | 12M | |
| Manufacturing Rubber Products 1993 - 1999.pdf | 2007-06-19 18:56 | 13M | |
| Manufacturing Textfiles 1975 - 1982.pdf | 2007-06-19 18:56 | 20M | |
| Manufacturing Textfiles 1983 - 1988.pdf | 2007-06-19 18:56 | 15M | |
| Manufacturing Textfiles 1989 - 1992.pdf | 2007-06-19 18:56 | 20M | |
| Manufacturing Textfiles 1993 - 1995.pdf | 2007-06-19 18:56 | 13M | |
| Manufacturing Textfiles 1996 - 1999.pdf | 2007-06-19 18:57 | 11M | |
| Manufacturing Tobacco 1976 - 1992.pdf | 2007-06-19 18:57 | 15M | |
| Manufacturing Tobacco 1993 - 1997.pdf | 2007-06-19 18:57 | 15M | |
| Manufacturing Tobacco 1998.pdf | 2007-06-19 18:57 | 9.8M | |
| Manufacturing Wood & Cork 1975 - 1990.pdf | 2007-06-19 18:57 | 14M | |
| Manufacturing Wood & Cork 1991 - 1998.pdf | 2007-06-19 18:57 | 12M | |
| Migrant Labour Cape 1975 - 1982.pdf | 2007-06-19 18:57 | 14M | |
| Migrant Labour Cape 1983 - 1986.pdf | 2007-06-19 18:57 | 18M | |
| Migrant Labour Cape 1987 - 1992.pdf | 2007-06-19 18:57 | 2.6M | |
| Migrant Labour Family Life 1975 - 1986.pdf | 2007-06-19 18:57 | 5.6M | |
| Migrant Labour General 1975 - 1982.pdf | 2007-06-19 18:57 | 22M | |
| Migrant Labour General 1983 - 1986.pdf | 2007-06-19 18:57 | 22M | |
| Migrant Labour General 1987 - 1995.pdf | 2007-06-19 18:57 | 5.3M | |
| Migrant Labour Natal 1975 - 1994.pdf | 2007-06-19 18:57 | 4.1M | |
| Migrant Labour OFS 1975 - 1992.pdf | 2007-06-19 18:57 | 1.0M | |
| Migrant Labour Other Countries 1975 - 1993.pdf | 2007-06-19 18:57 | 9.4M | |
![[ ]](/icons/unknown.gif) | Migrant Labour Pass Laws 1975-78.PDF | 2007-06-19 18:58 | 18M | |
| Migrant Labour Pass Laws 1979 - 1980.pdf | 2007-06-19 18:58 | 23M | |
| Migrant Labour Pass Laws 1980 - 1981.pdf | 2007-06-19 18:58 | 28M | |
| Migrant Labour Pass Laws 1981.pdf | 2007-06-19 18:58 | 22M | |
| Migrant Labour Pass Laws 1982.pdf | 2007-06-19 18:58 | 15M | |
| Migrant Labour Pass Laws 1983.pdf | 2007-06-19 18:58 | 22M | |
| Migrant Labour Pass Laws 1984 - 1985.pdf | 2007-06-19 18:58 | 29M | |
| Migrant Labour Pass Laws 1986 - 1987.pdf | 2007-06-19 18:58 | 14M | |
| Migrant Labour Pass Laws 1988 - 1993.pdf | 2007-06-19 18:58 | 3.2M | |
| Migrant Labour Transvaal 1975 - 1985.pdf | 2007-06-19 18:58 | 18M | |
| Migrant Labour Transvaal 1986 - 1993.pdf | 2007-06-19 18:58 | 13M | |
| Mining Accidents 1974 - 1977.pdf | 2007-06-19 18:58 | 7.4M | |
| Mining Accidents 1978 - 1982.pdf | 2007-06-19 18:59 | 12M | |
| Mining Accidents 1983 - 1985.pdf | 2007-06-19 18:59 | 13M | |
| Mining Accidents 1986 - 1988.pdf | 2007-06-19 18:59 | 16M | |
| Mining Accidents 1989 - 1992.pdf | 2007-06-19 18:59 | 13M | |
| Mining Accidents 1993 - 1995.pdf | 2007-06-19 18:59 | 17M | |
| Mining Accidents 1996 - 1999.pdf | 2007-06-19 18:59 | 14M | |
| Mining Coal 1975 - 1980.pdf | 2007-06-19 18:59 | 18M | |
| Mining Coal 1981 - 1985.pdf | 2007-06-19 18:59 | 18M | |
| Mining Coal 1986 - 1989.pdf | 2007-06-19 18:59 | 11M | |
| Mining Coal 1990 - 1992.pdf | 2007-06-19 18:59 | 16M | |
| Mining Coal 1993 - 1999.pdf | 2007-06-19 19:00 | 14M | |
| Mining Diamonds 1975 - 1986.pdf | 2007-06-19 19:00 | 24M | |
| Mining Diamonds 1987 - 1991.pdf | 2007-06-19 19:00 | 19M | |
| Mining Diamonds 1992 - 1994.pdf | 2007-06-19 19:00 | 16M | |
| Mining Diamonds 1995 - 1999.pdf | 2007-06-19 19:00 | 20M | |
| Mining General 1977 - 1979.pdf | 2007-06-19 19:00 | 24M | |
| Mining General 1980 - 1981.pdf | 2007-06-19 19:01 | 19M | |
| Mining General 1982 - 1985.pdf | 2007-06-19 19:01 | 19M | |
| Mining General 1986 - 1988.pdf | 2007-06-19 19:01 | 31M | |
| Mining General 1989.pdf | 2007-06-19 19:01 | 9.1M | |
| Mining General 1990 - 1992.pdf | 2007-06-19 19:01 | 20M | |
| Mining General 1990.pdf | 2007-06-19 19:01 | 14M | |
| Mining General 1992 - 1993.pdf | 2007-06-19 19:01 | 4.9M | |
| Mining General 1994 - 1995.pdf | 2007-06-19 19:01 | 13M | |
| Mining General 1996 - 1998.pdf | 2007-06-19 19:01 | 5.4M | |
| Mining Gold 1975 - 1977.pdf | 2007-06-19 19:02 | 17M | |
| Mining Gold 1978 - 1979.pdf | 2007-06-19 19:02 | 14M | |
| Mining Gold 1980 - 1981.pdf | 2007-06-19 19:02 | 28M | |
| Mining Gold 1982 - 1986.pdf | 2007-06-19 19:02 | 25M | |
| Mining Gold 1987 - 1988.pdf | 2007-06-19 19:02 | 15M | |
| Mining Gold 1989 - 1990.pdf | 2007-06-19 19:02 | 22M | |
| Mining Gold 1989.pdf | 2007-06-19 19:02 | 17M | |
| Mining Gold 1990.pdf | 2007-06-19 19:02 | 18M | |
| Mining Gold 1991 - 1992.pdf | 2007-06-19 19:03 | 15M | |
| Mining Gold 1991.pdf | 2007-06-19 19:03 | 16M | |
| Mining Gold 1992 - 1993.pdf | 2007-06-19 19:03 | 21M | |
| Mining Gold 1994 - 1995.pdf | 2007-06-19 19:03 | 13M | |
| Mining Gold 1996 - 1998.pdf | 2007-06-19 18:38 | 18M | |
|
|---|